C13H15BrClNO3 — CID 103727030
2-(2-bromo-4-chlorophenoxy)-1-(3-hydroxy-3-methylpyrrolidin-1-yl)ethanone (PubChem CID 103727030) has the molecular formula C13H15BrClNO3 and a molecular weight of 348.62 g/mol. Its IUPAC name is 2-(2-bromo-4-chlorophenoxy)-1-(3-hydroxy-3-methylpyrrolidin-1-yl)ethanone.
| Compound Name | 2-(2-bromo-4-chlorophenoxy)-1-(3-hydroxy-3-methylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 103727030 |
| Molecular Formula | C13H15BrClNO3 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 2-(2-bromo-4-chlorophenoxy)-1-(3-hydroxy-3-methylpyrrolidin-1-yl)ethanone |
| SMILES | CC1(O)CCN(C(=O)COc2ccc(Cl)cc2Br)C1 |
| InChI | InChI=1S/C13H15BrClNO3/c1-13(18)4-5-16(8-13)12(17)7-19-11-3-2-9(15)6-10(11)14/h2-3,6,18H,4-5,7-8H2,1H3 |
| InChIKey | ZYCRCSXZTJKKPT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |