C11H15ClINO3S — CID 103729090
N-(2-chloro-4-iodophenyl)-2-propan-2-yloxyethanesulfonamide (PubChem CID 103729090) has the molecular formula C11H15ClINO3S and a molecular weight of 403.67 g/mol. Its IUPAC name is N-(2-chloro-4-iodophenyl)-2-propan-2-yloxyethanesulfonamide.
| Compound Name | N-(2-chloro-4-iodophenyl)-2-propan-2-yloxyethanesulfonamide |
|---|---|
| PubChem CID | 103729090 |
| Molecular Formula | C11H15ClINO3S |
| Molecular Weight | 403.67 g/mol |
| Exact Mass | 402.95 |
| IUPAC Name | N-(2-chloro-4-iodophenyl)-2-propan-2-yloxyethanesulfonamide |
| SMILES | CC(C)OCCS(=O)(=O)Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C11H15ClINO3S/c1-8(2)17-5-6-18(15,16)14-11-4-3-9(13)7-10(11)12/h3-4,7-8,14H,5-6H2,1-2H3 |
| InChIKey | NGHQGLYLBMWJSZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.67 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|