C14H14BrFN2O3 — CID 103729099
3-[(3-bromo-5-fluorophenyl)methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 103729099) has the molecular formula C14H14BrFN2O3 and a molecular weight of 357.18 g/mol. Its IUPAC name is 3-[(3-bromo-5-fluorophenyl)methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(3-bromo-5-fluorophenyl)methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 103729099 |
| Molecular Formula | C14H14BrFN2O3 |
| Molecular Weight | 357.18 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 3-[(3-bromo-5-fluorophenyl)methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCOCC2)C(=O)N1Cc1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C14H14BrFN2O3/c15-10-5-9(6-11(16)7-10)8-18-12(19)14(17-13(18)20)1-3-21-4-2-14/h5-7H,1-4,8H2,(H,17,20) |
| InChIKey | UUUWZEQRRSUBBI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.18 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|