C43H58N6O6 — CID 10372921
(1R,8S,11R,18S,21R,24S)-11,21-dibenzyl-24-[(2S)-butan-2-yl]-10-methyl-3,10,13,20,23,26-hexazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone (PubChem CID 10372921) has the molecular formula C43H58N6O6 and a molecular weight of 754.97 g/mol. Its IUPAC name is (1R,8S,11R,18S,21R,24S)-11,21-dibenzyl-24-[(2S)-butan-2-yl]-10-methyl-3,10,13,20,23,26-hexazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone.
| Compound Name | (1R,8S,11R,18S,21R,24S)-11,21-dibenzyl-24-[(2S)-butan-2-yl]-10-methyl-3,10,13,20,23,26-hexazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone |
|---|---|
| PubChem CID | 10372921 |
| Molecular Formula | C43H58N6O6 |
| Molecular Weight | 754.97 g/mol |
| Exact Mass | 754.44 |
| IUPAC Name | (1R,8S,11R,18S,21R,24S)-11,21-dibenzyl-24-[(2S)-butan-2-yl]-10-methyl-3,10,13,20,23,26-hexazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H]2CCCCN2C(=O)[C@@H](Cc2ccccc2)N(C)C(=O)[C@@H]2CCCCN2C(=O)[C@H]2CCCCN2C1=O |
| InChI | InChI=1S/C43H58N6O6/c1-4-29(2)37-43(55)49-26-16-13-23-35(49)41(53)48-25-15-12-22-34(48)40(52)46(3)36(28-31-19-9-6-10-20-31)42(54)47-24-14-11-21-33(47)39(51)44-32(38(50)45-37)27-30-17-7-5-8-18-30/h5-10,17-20,29,32-37H,4,11-16,21-28H2,1-3H3,(H,44,51)(H,45,50)/t29-,32+,33-,34-,35+,36+,37-/m0/s1 |
| InChIKey | AYGIPDNOMKZKGS-KDPLRFIXSA-N |
| XLogP | 3.47 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.97 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |