C16H28N4O2 — CID 103729464
tert-butyl 4-[2-(1-methylpyrazol-4-yl)ethylamino]piperidine-1-carboxylate (PubChem CID 103729464) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is tert-butyl 4-[2-(1-methylpyrazol-4-yl)ethylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(1-methylpyrazol-4-yl)ethylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103729464 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | tert-butyl 4-[2-(1-methylpyrazol-4-yl)ethylamino]piperidine-1-carboxylate |
| SMILES | Cn1cc(CCNC2CCN(C(=O)OC(C)(C)C)CC2)cn1 |
| InChI | InChI=1S/C16H28N4O2/c1-16(2,3)22-15(21)20-9-6-14(7-10-20)17-8-5-13-11-18-19(4)12-13/h11-12,14,17H,5-10H2,1-4H3 |
| InChIKey | SOZZKZPQZVHHCE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |