C13H8F18I2 — CID 10372957
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10-pentadecafluoro-1,12-diiodo-10-(trifluoromethyl)dodecane (PubChem CID 10372957) has the molecular formula C13H8F18I2 and a molecular weight of 759.98 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10-pentadecafluoro-1,12-diiodo-10-(trifluoromethyl)dodecane.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10-pentadecafluoro-1,12-diiodo-10-(trifluoromethyl)dodecane |
|---|---|
| PubChem CID | 10372957 |
| Molecular Formula | C13H8F18I2 |
| Molecular Weight | 759.98 g/mol |
| Exact Mass | 759.84 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10-pentadecafluoro-1,12-diiodo-10-(trifluoromethyl)dodecane |
| SMILES | FC(F)(F)C(F)(CCI)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCI |
| InChI | InChI=1S/C13H8F18I2/c14-5(1-3-32,13(29,30)31)7(17,18)9(21,22)11(25,26)12(27,28)10(23,24)8(19,20)6(15,16)2-4-33/h1-4H2 |
| InChIKey | JNQXRXWJRPEMJO-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.98 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|