C16H18BrNO — CID 103729730
(2S)-2-[1-(4-bromophenyl)ethylamino]-2-phenylethanol (PubChem CID 103729730) has the molecular formula C16H18BrNO and a molecular weight of 320.23 g/mol. Its IUPAC name is (2S)-2-[1-(4-bromophenyl)ethylamino]-2-phenylethanol.
| Compound Name | (2S)-2-[1-(4-bromophenyl)ethylamino]-2-phenylethanol |
|---|---|
| PubChem CID | 103729730 |
| Molecular Formula | C16H18BrNO |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | (2S)-2-[1-(4-bromophenyl)ethylamino]-2-phenylethanol |
| SMILES | CC(N[C@H](CO)c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H18BrNO/c1-12(13-7-9-15(17)10-8-13)18-16(11-19)14-5-3-2-4-6-14/h2-10,12,16,18-19H,11H2,1H3/t12?,16-/m1/s1 |
| InChIKey | MZTFGEPQCFQDRO-PVQCJRHBSA-N |
| XLogP | 3.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |