C14H20F2N2O — CID 103731452
1,1-difluoro-3-[(4-pyrrolidin-1-ylphenyl)methylamino]propan-2-ol (PubChem CID 103731452) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is 1,1-difluoro-3-[(4-pyrrolidin-1-ylphenyl)methylamino]propan-2-ol.
| Compound Name | 1,1-difluoro-3-[(4-pyrrolidin-1-ylphenyl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 103731452 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1,1-difluoro-3-[(4-pyrrolidin-1-ylphenyl)methylamino]propan-2-ol |
| SMILES | OC(CNCc1ccc(N2CCCC2)cc1)C(F)F |
| InChI | InChI=1S/C14H20F2N2O/c15-14(16)13(19)10-17-9-11-3-5-12(6-4-11)18-7-1-2-8-18/h3-6,13-14,17,19H,1-2,7-10H2 |
| InChIKey | BFRHYXIYQFVBIK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|