About 1,1-difluoro-3-(1,3-thiazol-4-ylmethylamino)propan-2-ol
1,1-difluoro-3-(1,3-thiazol-4-ylmethylamino)propan-2-ol (PubChem CID 103731456) has the molecular formula C7H10F2N2OS
and a molecular weight of 208.23 g/mol. Its IUPAC name is 1,1-difluoro-3-(1,3-thiazol-4-ylmethylamino)propan-2-ol.
Molecular Properties
| Compound Name | 1,1-difluoro-3-(1,3-thiazol-4-ylmethylamino)propan-2-ol |
| PubChem CID | 103731456 |
| Molecular Formula | C7H10F2N2OS |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 1,1-difluoro-3-(1,3-thiazol-4-ylmethylamino)propan-2-ol |
| SMILES | OC(CNCc1cscn1)C(F)F |
| InChI | InChI=1S/C7H10F2N2OS/c8-7(9)6(12)2-10-1-5-3-13-4-11-5/h3-4,6-7,10,12H,1-2H2 |
| InChIKey | QPBIAQYLZOEFNF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,1-difluoro-3-(1,3-thiazol-4-ylmethylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-3-(1,3-thiazol-4-ylmethylamino)propan-2-ol?
The IUPAC name of 1,1-difluoro-3-(1,3-thiazol-4-ylmethylamino)propan-2-ol (CID 103731456) is 1,1-difluoro-3-(1,3-thiazol-4-ylmethylamino)propan-2-ol.
What is the SMILES notation for 1,1-difluoro-3-(1,3-thiazol-4-ylmethylamino)propan-2-ol?
The canonical SMILES for 1,1-difluoro-3-(1,3-thiazol-4-ylmethylamino)propan-2-ol is OC(CNCc1cscn1)C(F)F.
What is the InChIKey of 1,1-difluoro-3-(1,3-thiazol-4-ylmethylamino)propan-2-ol?
The InChIKey is QPBIAQYLZOEFNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2N2OS/c8-7(9)6(12)2-10-1-5-3-13-4-11-5/h3-4,6-7,10,12H,1-2H2.
What are the key properties of 1,1-difluoro-3-(1,3-thiazol-4-ylmethylamino)propan-2-ol?
1,1-difluoro-3-(1,3-thiazol-4-ylmethylamino)propan-2-ol has a molecular weight of 208.23 g/mol, XLogP of 0.86, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-3-(1,3-thiazol-4-ylmethylamino)propan-2-ol is sourced from PubChem (CID 103731456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).