About 3-[(5-bromothiophen-3-yl)methylamino]-1,1-difluoropropan-2-ol
3-[(5-bromothiophen-3-yl)methylamino]-1,1-difluoropropan-2-ol (PubChem CID 103731524) has the molecular formula C8H10BrF2NOS
and a molecular weight of 286.14 g/mol. Its IUPAC name is 3-[(5-bromothiophen-3-yl)methylamino]-1,1-difluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-[(5-bromothiophen-3-yl)methylamino]-1,1-difluoropropan-2-ol |
| PubChem CID | 103731524 |
| Molecular Formula | C8H10BrF2NOS |
| Molecular Weight | 286.14 g/mol |
| Exact Mass | 284.96 |
| IUPAC Name | 3-[(5-bromothiophen-3-yl)methylamino]-1,1-difluoropropan-2-ol |
| SMILES | OC(CNCc1csc(Br)c1)C(F)F |
| InChI | InChI=1S/C8H10BrF2NOS/c9-7-1-5(4-14-7)2-12-3-6(13)8(10)11/h1,4,6,8,12-13H,2-3H2 |
| InChIKey | CIYRLVFOBBYYNV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.14 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(5-bromothiophen-3-yl)methylamino]-1,1-difluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-bromothiophen-3-yl)methylamino]-1,1-difluoropropan-2-ol?
The IUPAC name of 3-[(5-bromothiophen-3-yl)methylamino]-1,1-difluoropropan-2-ol (CID 103731524) is 3-[(5-bromothiophen-3-yl)methylamino]-1,1-difluoropropan-2-ol.
What is the SMILES notation for 3-[(5-bromothiophen-3-yl)methylamino]-1,1-difluoropropan-2-ol?
The canonical SMILES for 3-[(5-bromothiophen-3-yl)methylamino]-1,1-difluoropropan-2-ol is OC(CNCc1csc(Br)c1)C(F)F.
What is the InChIKey of 3-[(5-bromothiophen-3-yl)methylamino]-1,1-difluoropropan-2-ol?
The InChIKey is CIYRLVFOBBYYNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrF2NOS/c9-7-1-5(4-14-7)2-12-3-6(13)8(10)11/h1,4,6,8,12-13H,2-3H2.
What are the key properties of 3-[(5-bromothiophen-3-yl)methylamino]-1,1-difluoropropan-2-ol?
3-[(5-bromothiophen-3-yl)methylamino]-1,1-difluoropropan-2-ol has a molecular weight of 286.14 g/mol, XLogP of 2.23, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-bromothiophen-3-yl)methylamino]-1,1-difluoropropan-2-ol is sourced from PubChem (CID 103731524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).