C12H17F2NO2 — CID 103731605
3-[(3-ethoxyphenyl)methylamino]-1,1-difluoropropan-2-ol (PubChem CID 103731605) has the molecular formula C12H17F2NO2 and a molecular weight of 245.27 g/mol. Its IUPAC name is 3-[(3-ethoxyphenyl)methylamino]-1,1-difluoropropan-2-ol.
| Compound Name | 3-[(3-ethoxyphenyl)methylamino]-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 103731605 |
| Molecular Formula | C12H17F2NO2 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 3-[(3-ethoxyphenyl)methylamino]-1,1-difluoropropan-2-ol |
| SMILES | CCOc1cccc(CNCC(O)C(F)F)c1 |
| InChI | InChI=1S/C12H17F2NO2/c1-2-17-10-5-3-4-9(6-10)7-15-8-11(16)12(13)14/h3-6,11-12,15-16H,2,7-8H2,1H3 |
| InChIKey | IVXCFJDYTDKERC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |