About 5-[(3,3-difluoro-2-hydroxypropyl)amino]-4,4-dimethylpentanenitrile
5-[(3,3-difluoro-2-hydroxypropyl)amino]-4,4-dimethylpentanenitrile (PubChem CID 103731617) has the molecular formula C10H18F2N2O
and a molecular weight of 220.26 g/mol. Its IUPAC name is 5-[(3,3-difluoro-2-hydroxypropyl)amino]-4,4-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 5-[(3,3-difluoro-2-hydroxypropyl)amino]-4,4-dimethylpentanenitrile |
| PubChem CID | 103731617 |
| Molecular Formula | C10H18F2N2O |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 5-[(3,3-difluoro-2-hydroxypropyl)amino]-4,4-dimethylpentanenitrile |
| SMILES | CC(C)(CCC#N)CNCC(O)C(F)F |
| InChI | InChI=1S/C10H18F2N2O/c1-10(2,4-3-5-13)7-14-6-8(15)9(11)12/h8-9,14-15H,3-4,6-7H2,1-2H3 |
| InChIKey | CEBFGVSHQFFEKV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(3,3-difluoro-2-hydroxypropyl)amino]-4,4-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,3-difluoro-2-hydroxypropyl)amino]-4,4-dimethylpentanenitrile?
The IUPAC name of 5-[(3,3-difluoro-2-hydroxypropyl)amino]-4,4-dimethylpentanenitrile (CID 103731617) is 5-[(3,3-difluoro-2-hydroxypropyl)amino]-4,4-dimethylpentanenitrile.
What is the SMILES notation for 5-[(3,3-difluoro-2-hydroxypropyl)amino]-4,4-dimethylpentanenitrile?
The canonical SMILES for 5-[(3,3-difluoro-2-hydroxypropyl)amino]-4,4-dimethylpentanenitrile is CC(C)(CCC#N)CNCC(O)C(F)F.
What is the InChIKey of 5-[(3,3-difluoro-2-hydroxypropyl)amino]-4,4-dimethylpentanenitrile?
The InChIKey is CEBFGVSHQFFEKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O/c1-10(2,4-3-5-13)7-14-6-8(15)9(11)12/h8-9,14-15H,3-4,6-7H2,1-2H3.
What are the key properties of 5-[(3,3-difluoro-2-hydroxypropyl)amino]-4,4-dimethylpentanenitrile?
5-[(3,3-difluoro-2-hydroxypropyl)amino]-4,4-dimethylpentanenitrile has a molecular weight of 220.26 g/mol, XLogP of 1.53, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,3-difluoro-2-hydroxypropyl)amino]-4,4-dimethylpentanenitrile is sourced from PubChem (CID 103731617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).