About 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-1,1-difluoropropan-2-ol
3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-1,1-difluoropropan-2-ol (PubChem CID 103731635) has the molecular formula C11H19F2N3OS
and a molecular weight of 279.36 g/mol. Its IUPAC name is 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-1,1-difluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-1,1-difluoropropan-2-ol |
| PubChem CID | 103731635 |
| Molecular Formula | C11H19F2N3OS |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-1,1-difluoropropan-2-ol |
| SMILES | CCN(CC)c1ncc(CNCC(O)C(F)F)s1 |
| InChI | InChI=1S/C11H19F2N3OS/c1-3-16(4-2)11-15-6-8(18-11)5-14-7-9(17)10(12)13/h6,9-10,14,17H,3-5,7H2,1-2H3 |
| InChIKey | XBUGJJSXFMBUHW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-1,1-difluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-1,1-difluoropropan-2-ol?
The IUPAC name of 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-1,1-difluoropropan-2-ol (CID 103731635) is 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-1,1-difluoropropan-2-ol.
What is the SMILES notation for 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-1,1-difluoropropan-2-ol?
The canonical SMILES for 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-1,1-difluoropropan-2-ol is CCN(CC)c1ncc(CNCC(O)C(F)F)s1.
What is the InChIKey of 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-1,1-difluoropropan-2-ol?
The InChIKey is XBUGJJSXFMBUHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2N3OS/c1-3-16(4-2)11-15-6-8(18-11)5-14-7-9(17)10(12)13/h6,9-10,14,17H,3-5,7H2,1-2H3.
What are the key properties of 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-1,1-difluoropropan-2-ol?
3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-1,1-difluoropropan-2-ol has a molecular weight of 279.36 g/mol, XLogP of 1.70, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(diethylamino)-1,3-thiazol-5-yl]methylamino]-1,1-difluoropropan-2-ol is sourced from PubChem (CID 103731635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).