About 5-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]thiophene-3-carbonitrile
5-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]thiophene-3-carbonitrile (PubChem CID 103731649) has the molecular formula C9H10F2N2OS
and a molecular weight of 232.25 g/mol. Its IUPAC name is 5-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]thiophene-3-carbonitrile.
Molecular Properties
| Compound Name | 5-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]thiophene-3-carbonitrile |
| PubChem CID | 103731649 |
| Molecular Formula | C9H10F2N2OS |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 5-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]thiophene-3-carbonitrile |
| SMILES | N#Cc1csc(CNCC(O)C(F)F)c1 |
| InChI | InChI=1S/C9H10F2N2OS/c10-9(11)8(14)4-13-3-7-1-6(2-12)5-15-7/h1,5,8-9,13-14H,3-4H2 |
| InChIKey | AEUHDHCRCFHCGQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]thiophene-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]thiophene-3-carbonitrile?
The IUPAC name of 5-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]thiophene-3-carbonitrile (CID 103731649) is 5-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]thiophene-3-carbonitrile.
What is the SMILES notation for 5-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]thiophene-3-carbonitrile?
The canonical SMILES for 5-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]thiophene-3-carbonitrile is N#Cc1csc(CNCC(O)C(F)F)c1.
What is the InChIKey of 5-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]thiophene-3-carbonitrile?
The InChIKey is AEUHDHCRCFHCGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2N2OS/c10-9(11)8(14)4-13-3-7-1-6(2-12)5-15-7/h1,5,8-9,13-14H,3-4H2.
What are the key properties of 5-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]thiophene-3-carbonitrile?
5-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]thiophene-3-carbonitrile has a molecular weight of 232.25 g/mol, XLogP of 1.34, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]thiophene-3-carbonitrile is sourced from PubChem (CID 103731649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).