C12H17F4NO — CID 103731894
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 103731894) has the molecular formula C12H17F4NO and a molecular weight of 267.27 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103731894 |
| Molecular Formula | C12H17F4NO |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | CC(NC(=O)C(F)(F)C(F)F)C1CC2CCC1C2 |
| InChI | InChI=1S/C12H17F4NO/c1-6(9-5-7-2-3-8(9)4-7)17-11(18)12(15,16)10(13)14/h6-10H,2-5H2,1H3,(H,17,18) |
| InChIKey | PUYWZWPNBDFKBB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|