C12H10F4N2O3 — CID 103732683
2,2,3,3-tetrafluoro-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propanamide (PubChem CID 103732683) has the molecular formula C12H10F4N2O3 and a molecular weight of 306.22 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 103732683 |
| Molecular Formula | C12H10F4N2O3 |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]propanamide |
| SMILES | O=C1OCCN1c1cccc(NC(=O)C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C12H10F4N2O3/c13-9(14)12(15,16)10(19)17-7-2-1-3-8(6-7)18-4-5-21-11(18)20/h1-3,6,9H,4-5H2,(H,17,19) |
| InChIKey | UFFQIMZXRZOSNM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|