C8H8F4N2OS — CID 103732943
N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103732943) has the molecular formula C8H8F4N2OS and a molecular weight of 256.22 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103732943 |
| Molecular Formula | C8H8F4N2OS |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | Cc1nc(NC(=O)C(F)(F)C(F)F)sc1C |
| InChI | InChI=1S/C8H8F4N2OS/c1-3-4(2)16-7(13-3)14-6(15)8(11,12)5(9)10/h5H,1-2H3,(H,13,14,15) |
| InChIKey | VMSBMYMSQUFCCS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|