C9H16F4N2O3S — CID 103733105
N-[3-[ethyl(methylsulfonyl)amino]propyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 103733105) has the molecular formula C9H16F4N2O3S and a molecular weight of 308.30 g/mol. Its IUPAC name is N-[3-[ethyl(methylsulfonyl)amino]propyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103733105 |
| Molecular Formula | C9H16F4N2O3S |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | CCN(CCCNC(=O)C(F)(F)C(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C9H16F4N2O3S/c1-3-15(19(2,17)18)6-4-5-14-8(16)9(12,13)7(10)11/h7H,3-6H2,1-2H3,(H,14,16) |
| InChIKey | HLWRNGUDSRADGH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|