C10H13F4NO3 — CID 103733224
ethyl 2-[cyclopropyl(2,2,3,3-tetrafluoropropanoyl)amino]acetate (PubChem CID 103733224) has the molecular formula C10H13F4NO3 and a molecular weight of 271.21 g/mol. Its IUPAC name is ethyl 2-[cyclopropyl(2,2,3,3-tetrafluoropropanoyl)amino]acetate.
| Compound Name | ethyl 2-[cyclopropyl(2,2,3,3-tetrafluoropropanoyl)amino]acetate |
|---|---|
| PubChem CID | 103733224 |
| Molecular Formula | C10H13F4NO3 |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | ethyl 2-[cyclopropyl(2,2,3,3-tetrafluoropropanoyl)amino]acetate |
| SMILES | CCOC(=O)CN(C(=O)C(F)(F)C(F)F)C1CC1 |
| InChI | InChI=1S/C10H13F4NO3/c1-2-18-7(16)5-15(6-3-4-6)9(17)10(13,14)8(11)12/h6,8H,2-5H2,1H3 |
| InChIKey | RYSVYVBSBPEEJC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|