C7H11F4NO3S — CID 103733503
2,2,3,3-tetrafluoro-N-methyl-N-(2-methylsulfonylethyl)propanamide (PubChem CID 103733503) has the molecular formula C7H11F4NO3S and a molecular weight of 265.23 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-methyl-N-(2-methylsulfonylethyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-methyl-N-(2-methylsulfonylethyl)propanamide |
|---|---|
| PubChem CID | 103733503 |
| Molecular Formula | C7H11F4NO3S |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-methyl-N-(2-methylsulfonylethyl)propanamide |
| SMILES | CN(CCS(C)(=O)=O)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H11F4NO3S/c1-12(3-4-16(2,14)15)6(13)7(10,11)5(8)9/h5H,3-4H2,1-2H3 |
| InChIKey | RLKXGEUXAJHWGY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|