C8H9F4N3O2 — CID 103733619
2,2,3,3-tetrafluoro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]propanamide (PubChem CID 103733619) has the molecular formula C8H9F4N3O2 and a molecular weight of 255.17 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 103733619 |
| Molecular Formula | C8H9F4N3O2 |
| Molecular Weight | 255.17 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]propanamide |
| SMILES | Cc1nc(CCNC(=O)C(F)(F)C(F)F)no1 |
| InChI | InChI=1S/C8H9F4N3O2/c1-4-14-5(15-17-4)2-3-13-7(16)8(11,12)6(9)10/h6H,2-3H2,1H3,(H,13,16) |
| InChIKey | SCWVMVPLKLUTRS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.17 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|