C7H8F4N2O — CID 103733657
N-(2-cyanopropan-2-yl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103733657) has the molecular formula C7H8F4N2O and a molecular weight of 212.15 g/mol. Its IUPAC name is N-(2-cyanopropan-2-yl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(2-cyanopropan-2-yl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103733657 |
| Molecular Formula | C7H8F4N2O |
| Molecular Weight | 212.15 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | N-(2-cyanopropan-2-yl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | CC(C)(C#N)NC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H8F4N2O/c1-6(2,3-12)13-5(14)7(10,11)4(8)9/h4H,1-2H3,(H,13,14) |
| InChIKey | YFQIGCNNAIIASA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.15 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|