C8H11F4NO3S — CID 103733698
1-(1,1-dioxo-1,4-thiazepan-4-yl)-2,2,3,3-tetrafluoropropan-1-one (PubChem CID 103733698) has the molecular formula C8H11F4NO3S and a molecular weight of 277.24 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,4-thiazepan-4-yl)-2,2,3,3-tetrafluoropropan-1-one.
| Compound Name | 1-(1,1-dioxo-1,4-thiazepan-4-yl)-2,2,3,3-tetrafluoropropan-1-one |
|---|---|
| PubChem CID | 103733698 |
| Molecular Formula | C8H11F4NO3S |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 1-(1,1-dioxo-1,4-thiazepan-4-yl)-2,2,3,3-tetrafluoropropan-1-one |
| SMILES | O=C(N1CCCS(=O)(=O)CC1)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H11F4NO3S/c9-6(10)8(11,12)7(14)13-2-1-4-17(15,16)5-3-13/h6H,1-5H2 |
| InChIKey | AFJFQWFQOKUGRG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|