C10H16F4N2O3 — CID 103733766
N-[2-(dimethylamino)-2-oxoethyl]-2,2,3,3-tetrafluoro-N-(2-methoxyethyl)propanamide (PubChem CID 103733766) has the molecular formula C10H16F4N2O3 and a molecular weight of 288.24 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-oxoethyl]-2,2,3,3-tetrafluoro-N-(2-methoxyethyl)propanamide.
| Compound Name | N-[2-(dimethylamino)-2-oxoethyl]-2,2,3,3-tetrafluoro-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 103733766 |
| Molecular Formula | C10H16F4N2O3 |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-[2-(dimethylamino)-2-oxoethyl]-2,2,3,3-tetrafluoro-N-(2-methoxyethyl)propanamide |
| SMILES | COCCN(CC(=O)N(C)C)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H16F4N2O3/c1-15(2)7(17)6-16(4-5-19-3)9(18)10(13,14)8(11)12/h8H,4-6H2,1-3H3 |
| InChIKey | GCOWIAJLNRBCDF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|