C7H7F4N3O2 — CID 103733850
2,2,3,3-tetrafluoro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide (PubChem CID 103733850) has the molecular formula C7H7F4N3O2 and a molecular weight of 241.14 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 103733850 |
| Molecular Formula | C7H7F4N3O2 |
| Molecular Weight | 241.14 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]propanamide |
| SMILES | O=C(NCCc1ncon1)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H7F4N3O2/c8-5(9)7(10,11)6(15)12-2-1-4-13-3-16-14-4/h3,5H,1-2H2,(H,12,15) |
| InChIKey | YWNMCLXULLOCIS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.14 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|