C8H11F4NOS — CID 103733919
2,2,3,3-tetrafluoro-1-(3-methylthiomorpholin-4-yl)propan-1-one (PubChem CID 103733919) has the molecular formula C8H11F4NOS and a molecular weight of 245.24 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-1-(3-methylthiomorpholin-4-yl)propan-1-one.
| Compound Name | 2,2,3,3-tetrafluoro-1-(3-methylthiomorpholin-4-yl)propan-1-one |
|---|---|
| PubChem CID | 103733919 |
| Molecular Formula | C8H11F4NOS |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2,2,3,3-tetrafluoro-1-(3-methylthiomorpholin-4-yl)propan-1-one |
| SMILES | CC1CSCCN1C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H11F4NOS/c1-5-4-15-3-2-13(5)7(14)8(11,12)6(9)10/h5-6H,2-4H2,1H3 |
| InChIKey | PRVSLXQESNLHRA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|