C8H13F4NO2S — CID 103733927
2,2,3,3-tetrafluoro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)propanamide (PubChem CID 103733927) has the molecular formula C8H13F4NO2S and a molecular weight of 263.26 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)propanamide |
|---|---|
| PubChem CID | 103733927 |
| Molecular Formula | C8H13F4NO2S |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)propanamide |
| SMILES | CSCC(C)(O)CNC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H13F4NO2S/c1-7(15,4-16-2)3-13-6(14)8(11,12)5(9)10/h5,15H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | GFBFCFQEBOQREZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|