C11H17F4NO2 — CID 103733930
N-(3-ethoxy-2,2-dimethylcyclobutyl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103733930) has the molecular formula C11H17F4NO2 and a molecular weight of 271.25 g/mol. Its IUPAC name is N-(3-ethoxy-2,2-dimethylcyclobutyl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103733930 |
| Molecular Formula | C11H17F4NO2 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | CCOC1CC(NC(=O)C(F)(F)C(F)F)C1(C)C |
| InChI | InChI=1S/C11H17F4NO2/c1-4-18-7-5-6(10(7,2)3)16-9(17)11(14,15)8(12)13/h6-8H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | GIKKVUFMFIGRHW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|