C11H17F4NO — CID 103733980
N-(4,4-dimethylcyclohexyl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103733980) has the molecular formula C11H17F4NO and a molecular weight of 255.25 g/mol. Its IUPAC name is N-(4,4-dimethylcyclohexyl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(4,4-dimethylcyclohexyl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103733980 |
| Molecular Formula | C11H17F4NO |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | N-(4,4-dimethylcyclohexyl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | CC1(C)CCC(NC(=O)C(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C11H17F4NO/c1-10(2)5-3-7(4-6-10)16-9(17)11(14,15)8(12)13/h7-8H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | RDYJPIYOJVGSKU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|