C10H12F4N2OS — CID 103734221
N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 103734221) has the molecular formula C10H12F4N2OS and a molecular weight of 284.28 g/mol. Its IUPAC name is N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103734221 |
| Molecular Formula | C10H12F4N2OS |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | CCc1cnc(C(C)NC(=O)C(F)(F)C(F)F)s1 |
| InChI | InChI=1S/C10H12F4N2OS/c1-3-6-4-15-7(18-6)5(2)16-9(17)10(13,14)8(11)12/h4-5,8H,3H2,1-2H3,(H,16,17) |
| InChIKey | CWMHHFZUOSOPLD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|