About 1-cyclobutyl-3-(3,3-difluoro-2-hydroxypropyl)urea
1-cyclobutyl-3-(3,3-difluoro-2-hydroxypropyl)urea (PubChem CID 103734265) has the molecular formula C8H14F2N2O2
and a molecular weight of 208.21 g/mol. Its IUPAC name is 1-cyclobutyl-3-(3,3-difluoro-2-hydroxypropyl)urea.
Molecular Properties
| Compound Name | 1-cyclobutyl-3-(3,3-difluoro-2-hydroxypropyl)urea |
| PubChem CID | 103734265 |
| Molecular Formula | C8H14F2N2O2 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-cyclobutyl-3-(3,3-difluoro-2-hydroxypropyl)urea |
| SMILES | O=C(NCC(O)C(F)F)NC1CCC1 |
| InChI | InChI=1S/C8H14F2N2O2/c9-7(10)6(13)4-11-8(14)12-5-2-1-3-5/h5-7,13H,1-4H2,(H2,11,12,14) |
| InChIKey | KENXCZMOVLKJHV-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclobutyl-3-(3,3-difluoro-2-hydroxypropyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutyl-3-(3,3-difluoro-2-hydroxypropyl)urea?
The IUPAC name of 1-cyclobutyl-3-(3,3-difluoro-2-hydroxypropyl)urea (CID 103734265) is 1-cyclobutyl-3-(3,3-difluoro-2-hydroxypropyl)urea.
What is the SMILES notation for 1-cyclobutyl-3-(3,3-difluoro-2-hydroxypropyl)urea?
The canonical SMILES for 1-cyclobutyl-3-(3,3-difluoro-2-hydroxypropyl)urea is O=C(NCC(O)C(F)F)NC1CCC1.
What is the InChIKey of 1-cyclobutyl-3-(3,3-difluoro-2-hydroxypropyl)urea?
The InChIKey is KENXCZMOVLKJHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2O2/c9-7(10)6(13)4-11-8(14)12-5-2-1-3-5/h5-7,13H,1-4H2,(H2,11,12,14).
What are the key properties of 1-cyclobutyl-3-(3,3-difluoro-2-hydroxypropyl)urea?
1-cyclobutyl-3-(3,3-difluoro-2-hydroxypropyl)urea has a molecular weight of 208.21 g/mol, XLogP of 0.46, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutyl-3-(3,3-difluoro-2-hydroxypropyl)urea is sourced from PubChem (CID 103734265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).