About 2-(3,3-difluoro-2-hydroxypropyl)-1-propan-2-ylguanidine
2-(3,3-difluoro-2-hydroxypropyl)-1-propan-2-ylguanidine (PubChem CID 103734422) has the molecular formula C7H15F2N3O
and a molecular weight of 195.21 g/mol. Its IUPAC name is 2-(3,3-difluoro-2-hydroxypropyl)-1-propan-2-ylguanidine.
Molecular Properties
| Compound Name | 2-(3,3-difluoro-2-hydroxypropyl)-1-propan-2-ylguanidine |
| PubChem CID | 103734422 |
| Molecular Formula | C7H15F2N3O |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | 2-(3,3-difluoro-2-hydroxypropyl)-1-propan-2-ylguanidine |
| SMILES | CC(C)N/C(N)=N/CC(O)C(F)F |
| InChI | InChI=1S/C7H15F2N3O/c1-4(2)12-7(10)11-3-5(13)6(8)9/h4-6,13H,3H2,1-2H3,(H3,10,11,12) |
| InChIKey | QCYIWLBTHGQSKL-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3-difluoro-2-hydroxypropyl)-1-propan-2-ylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-difluoro-2-hydroxypropyl)-1-propan-2-ylguanidine?
The IUPAC name of 2-(3,3-difluoro-2-hydroxypropyl)-1-propan-2-ylguanidine (CID 103734422) is 2-(3,3-difluoro-2-hydroxypropyl)-1-propan-2-ylguanidine.
What is the SMILES notation for 2-(3,3-difluoro-2-hydroxypropyl)-1-propan-2-ylguanidine?
The canonical SMILES for 2-(3,3-difluoro-2-hydroxypropyl)-1-propan-2-ylguanidine is CC(C)N/C(N)=N/CC(O)C(F)F.
What is the InChIKey of 2-(3,3-difluoro-2-hydroxypropyl)-1-propan-2-ylguanidine?
The InChIKey is QCYIWLBTHGQSKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F2N3O/c1-4(2)12-7(10)11-3-5(13)6(8)9/h4-6,13H,3H2,1-2H3,(H3,10,11,12).
What are the key properties of 2-(3,3-difluoro-2-hydroxypropyl)-1-propan-2-ylguanidine?
2-(3,3-difluoro-2-hydroxypropyl)-1-propan-2-ylguanidine has a molecular weight of 195.21 g/mol, XLogP of -0.07, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluoro-2-hydroxypropyl)-1-propan-2-ylguanidine is sourced from PubChem (CID 103734422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).