C12H11FN2O2 — CID 103734623
3-[2-(2-fluorophenyl)-2-hydroxyethyl]pyrimidin-4-one (PubChem CID 103734623) has the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. Its IUPAC name is 3-[2-(2-fluorophenyl)-2-hydroxyethyl]pyrimidin-4-one.
| Compound Name | 3-[2-(2-fluorophenyl)-2-hydroxyethyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 103734623 |
| Molecular Formula | C12H11FN2O2 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 3-[2-(2-fluorophenyl)-2-hydroxyethyl]pyrimidin-4-one |
| SMILES | O=c1ccncn1CC(O)c1ccccc1F |
| InChI | InChI=1S/C12H11FN2O2/c13-10-4-2-1-3-9(10)11(16)7-15-8-14-6-5-12(15)17/h1-6,8,11,16H,7H2 |
| InChIKey | PEPBQRHHZHGOPV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |