C14H16ClIN2O2 — CID 103734766
1-(3-chloro-4-iodobenzoyl)-N-methylpiperidine-4-carboxamide (PubChem CID 103734766) has the molecular formula C14H16ClIN2O2 and a molecular weight of 406.65 g/mol. Its IUPAC name is 1-(3-chloro-4-iodobenzoyl)-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-(3-chloro-4-iodobenzoyl)-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 103734766 |
| Molecular Formula | C14H16ClIN2O2 |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | 1-(3-chloro-4-iodobenzoyl)-N-methylpiperidine-4-carboxamide |
| SMILES | CNC(=O)C1CCN(C(=O)c2ccc(I)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H16ClIN2O2/c1-17-13(19)9-4-6-18(7-5-9)14(20)10-2-3-12(16)11(15)8-10/h2-3,8-9H,4-7H2,1H3,(H,17,19) |
| InChIKey | UJMOWMSRFNASGS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|