C13H16ClIN2O2 — CID 103735007
N-(2-amino-2-oxoethyl)-N-butyl-3-chloro-4-iodobenzamide (PubChem CID 103735007) has the molecular formula C13H16ClIN2O2 and a molecular weight of 394.64 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N-butyl-3-chloro-4-iodobenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-N-butyl-3-chloro-4-iodobenzamide |
|---|---|
| PubChem CID | 103735007 |
| Molecular Formula | C13H16ClIN2O2 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N-butyl-3-chloro-4-iodobenzamide |
| SMILES | CCCCN(CC(N)=O)C(=O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C13H16ClIN2O2/c1-2-3-6-17(8-12(16)18)13(19)9-4-5-11(15)10(14)7-9/h4-5,7H,2-3,6,8H2,1H3,(H2,16,18) |
| InChIKey | VXXRSEKXDFHPHK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|