About 4-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-2,6-difluorophenol
4-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-2,6-difluorophenol (PubChem CID 103735245) has the molecular formula C13H12ClF2NOS
and a molecular weight of 303.76 g/mol. Its IUPAC name is 4-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-2,6-difluorophenol.
Molecular Properties
| Compound Name | 4-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-2,6-difluorophenol |
| PubChem CID | 103735245 |
| Molecular Formula | C13H12ClF2NOS |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 4-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-2,6-difluorophenol |
| SMILES | Oc1c(F)cc(CNCCc2ccc(Cl)s2)cc1F |
| InChI | InChI=1S/C13H12ClF2NOS/c14-12-2-1-9(19-12)3-4-17-7-8-5-10(15)13(18)11(16)6-8/h1-2,5-6,17-18H,3-4,7H2 |
| InChIKey | JRUDSBNSYFAJDS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-2,6-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-2,6-difluorophenol?
The IUPAC name of 4-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-2,6-difluorophenol (CID 103735245) is 4-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-2,6-difluorophenol.
What is the SMILES notation for 4-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-2,6-difluorophenol?
The canonical SMILES for 4-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-2,6-difluorophenol is Oc1c(F)cc(CNCCc2ccc(Cl)s2)cc1F.
What is the InChIKey of 4-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-2,6-difluorophenol?
The InChIKey is JRUDSBNSYFAJDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClF2NOS/c14-12-2-1-9(19-12)3-4-17-7-8-5-10(15)13(18)11(16)6-8/h1-2,5-6,17-18H,3-4,7H2.
What are the key properties of 4-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-2,6-difluorophenol?
4-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-2,6-difluorophenol has a molecular weight of 303.76 g/mol, XLogP of 3.72, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(5-chlorothiophen-2-yl)ethylamino]methyl]-2,6-difluorophenol is sourced from PubChem (CID 103735245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).