C12H18N2 — CID 103736819
N-[(1-ethylcyclopropyl)methyl]-5-methylpyridin-2-amine (PubChem CID 103736819) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is N-[(1-ethylcyclopropyl)methyl]-5-methylpyridin-2-amine.
| Compound Name | N-[(1-ethylcyclopropyl)methyl]-5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 103736819 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N-[(1-ethylcyclopropyl)methyl]-5-methylpyridin-2-amine |
| SMILES | CCC1(CNc2ccc(C)cn2)CC1 |
| InChI | InChI=1S/C12H18N2/c1-3-12(6-7-12)9-14-11-5-4-10(2)8-13-11/h4-5,8H,3,6-7,9H2,1-2H3,(H,13,14) |
| InChIKey | RYBZYAACJFASRB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |