C13H16ClN3O4 — CID 103737148
3-chloro-N-methyl-N-[2-methyl-3-(methylamino)-3-oxopropyl]-2-nitrobenzamide (PubChem CID 103737148) has the molecular formula C13H16ClN3O4 and a molecular weight of 313.74 g/mol. Its IUPAC name is 3-chloro-N-methyl-N-[2-methyl-3-(methylamino)-3-oxopropyl]-2-nitrobenzamide.
| Compound Name | 3-chloro-N-methyl-N-[2-methyl-3-(methylamino)-3-oxopropyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 103737148 |
| Molecular Formula | C13H16ClN3O4 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 3-chloro-N-methyl-N-[2-methyl-3-(methylamino)-3-oxopropyl]-2-nitrobenzamide |
| SMILES | CNC(=O)C(C)CN(C)C(=O)c1cccc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16ClN3O4/c1-8(12(18)15-2)7-16(3)13(19)9-5-4-6-10(14)11(9)17(20)21/h4-6,8H,7H2,1-3H3,(H,15,18) |
| InChIKey | PWNYKUDBESATIA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|