C9H13F4NO — CID 103737217
N-[(1-ethylcyclopropyl)methyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 103737217) has the molecular formula C9H13F4NO and a molecular weight of 227.20 g/mol. Its IUPAC name is N-[(1-ethylcyclopropyl)methyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[(1-ethylcyclopropyl)methyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103737217 |
| Molecular Formula | C9H13F4NO |
| Molecular Weight | 227.20 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | N-[(1-ethylcyclopropyl)methyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | CCC1(CNC(=O)C(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C9H13F4NO/c1-2-8(3-4-8)5-14-7(15)9(12,13)6(10)11/h6H,2-5H2,1H3,(H,14,15) |
| InChIKey | YTQGDDXQSBBGTB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|