C12H21NO2S — CID 103740109
methyl 4-(2,2-dimethylthiomorpholin-4-yl)-2-methylbut-2-enoate (PubChem CID 103740109) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is methyl 4-(2,2-dimethylthiomorpholin-4-yl)-2-methylbut-2-enoate.
| Compound Name | methyl 4-(2,2-dimethylthiomorpholin-4-yl)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 103740109 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | methyl 4-(2,2-dimethylthiomorpholin-4-yl)-2-methylbut-2-enoate |
| SMILES | COC(=O)C(C)=CCN1CCSC(C)(C)C1 |
| InChI | InChI=1S/C12H21NO2S/c1-10(11(14)15-4)5-6-13-7-8-16-12(2,3)9-13/h5H,6-9H2,1-4H3 |
| InChIKey | OQOLAOCOGOFNCU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|