C14H18F3NO2 — CID 103740393
[1-[[3-(trifluoromethoxy)phenyl]methylamino]cyclopentyl]methanol (PubChem CID 103740393) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is [1-[[3-(trifluoromethoxy)phenyl]methylamino]cyclopentyl]methanol.
| Compound Name | [1-[[3-(trifluoromethoxy)phenyl]methylamino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 103740393 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | [1-[[3-(trifluoromethoxy)phenyl]methylamino]cyclopentyl]methanol |
| SMILES | OCC1(NCc2cccc(OC(F)(F)F)c2)CCCC1 |
| InChI | InChI=1S/C14H18F3NO2/c15-14(16,17)20-12-5-3-4-11(8-12)9-18-13(10-19)6-1-2-7-13/h3-5,8,18-19H,1-2,6-7,9-10H2 |
| InChIKey | XDQGNCAEUJVRPF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |