C8H15F2NO — CID 103740416
3-(1-cyclopropylethylamino)-1,1-difluoropropan-2-ol (PubChem CID 103740416) has the molecular formula C8H15F2NO and a molecular weight of 179.21 g/mol. Its IUPAC name is 3-(1-cyclopropylethylamino)-1,1-difluoropropan-2-ol.
| Compound Name | 3-(1-cyclopropylethylamino)-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 103740416 |
| Molecular Formula | C8H15F2NO |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 3-(1-cyclopropylethylamino)-1,1-difluoropropan-2-ol |
| SMILES | CC(NCC(O)C(F)F)C1CC1 |
| InChI | InChI=1S/C8H15F2NO/c1-5(6-2-3-6)11-4-7(12)8(9)10/h5-8,11-12H,2-4H2,1H3 |
| InChIKey | JBMXMVUSSKVARR-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |