About 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-1,1-difluoropropan-2-ol
3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-1,1-difluoropropan-2-ol (PubChem CID 103741092) has the molecular formula C9H14F2N2OS
and a molecular weight of 236.29 g/mol. Its IUPAC name is 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-1,1-difluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-1,1-difluoropropan-2-ol |
| PubChem CID | 103741092 |
| Molecular Formula | C9H14F2N2OS |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-1,1-difluoropropan-2-ol |
| SMILES | CCc1ncc(CNCC(O)C(F)F)s1 |
| InChI | InChI=1S/C9H14F2N2OS/c1-2-8-13-4-6(15-8)3-12-5-7(14)9(10)11/h4,7,9,12,14H,2-3,5H2,1H3 |
| InChIKey | ATALVKJZAOIZLB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-1,1-difluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-1,1-difluoropropan-2-ol?
The IUPAC name of 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-1,1-difluoropropan-2-ol (CID 103741092) is 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-1,1-difluoropropan-2-ol.
What is the SMILES notation for 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-1,1-difluoropropan-2-ol?
The canonical SMILES for 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-1,1-difluoropropan-2-ol is CCc1ncc(CNCC(O)C(F)F)s1.
What is the InChIKey of 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-1,1-difluoropropan-2-ol?
The InChIKey is ATALVKJZAOIZLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2N2OS/c1-2-8-13-4-6(15-8)3-12-5-7(14)9(10)11/h4,7,9,12,14H,2-3,5H2,1H3.
What are the key properties of 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-1,1-difluoropropan-2-ol?
3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-1,1-difluoropropan-2-ol has a molecular weight of 236.29 g/mol, XLogP of 1.42, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-ethyl-1,3-thiazol-5-yl)methylamino]-1,1-difluoropropan-2-ol is sourced from PubChem (CID 103741092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).