C11H23N3 — CID 103742062
2-[(1-propan-2-ylcyclopropyl)methyl]-1-propylguanidine (PubChem CID 103742062) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is 2-[(1-propan-2-ylcyclopropyl)methyl]-1-propylguanidine.
| Compound Name | 2-[(1-propan-2-ylcyclopropyl)methyl]-1-propylguanidine |
|---|---|
| PubChem CID | 103742062 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 2-[(1-propan-2-ylcyclopropyl)methyl]-1-propylguanidine |
| SMILES | CCCN/C(N)=N/CC1(C(C)C)CC1 |
| InChI | InChI=1S/C11H23N3/c1-4-7-13-10(12)14-8-11(5-6-11)9(2)3/h9H,4-8H2,1-3H3,(H3,12,13,14) |
| InChIKey | CMFLFYQOXZGRHA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|