About 2-methoxy-1,1-dimethyl-4-(sulfamoylamino)cyclobutane
2-methoxy-1,1-dimethyl-4-(sulfamoylamino)cyclobutane (PubChem CID 103743710) has the molecular formula C7H16N2O3S
and a molecular weight of 208.28 g/mol. Its IUPAC name is 2-methoxy-1,1-dimethyl-4-(sulfamoylamino)cyclobutane.
Molecular Properties
| Compound Name | 2-methoxy-1,1-dimethyl-4-(sulfamoylamino)cyclobutane |
| PubChem CID | 103743710 |
| Molecular Formula | C7H16N2O3S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2-methoxy-1,1-dimethyl-4-(sulfamoylamino)cyclobutane |
| SMILES | COC1CC(NS(N)(=O)=O)C1(C)C |
| InChI | InChI=1S/C7H16N2O3S/c1-7(2)5(4-6(7)12-3)9-13(8,10)11/h5-6,9H,4H2,1-3H3,(H2,8,10,11) |
| InChIKey | GLPPAUPYOBRFCE-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-1,1-dimethyl-4-(sulfamoylamino)cyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1,1-dimethyl-4-(sulfamoylamino)cyclobutane?
The IUPAC name of 2-methoxy-1,1-dimethyl-4-(sulfamoylamino)cyclobutane (CID 103743710) is 2-methoxy-1,1-dimethyl-4-(sulfamoylamino)cyclobutane.
What is the SMILES notation for 2-methoxy-1,1-dimethyl-4-(sulfamoylamino)cyclobutane?
The canonical SMILES for 2-methoxy-1,1-dimethyl-4-(sulfamoylamino)cyclobutane is COC1CC(NS(N)(=O)=O)C1(C)C.
What is the InChIKey of 2-methoxy-1,1-dimethyl-4-(sulfamoylamino)cyclobutane?
The InChIKey is GLPPAUPYOBRFCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O3S/c1-7(2)5(4-6(7)12-3)9-13(8,10)11/h5-6,9H,4H2,1-3H3,(H2,8,10,11).
What are the key properties of 2-methoxy-1,1-dimethyl-4-(sulfamoylamino)cyclobutane?
2-methoxy-1,1-dimethyl-4-(sulfamoylamino)cyclobutane has a molecular weight of 208.28 g/mol, XLogP of -0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1,1-dimethyl-4-(sulfamoylamino)cyclobutane is sourced from PubChem (CID 103743710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).