C7H12N4O2 — CID 103743950
1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]urea (PubChem CID 103743950) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is 1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]urea.
| Compound Name | 1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 103743950 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1-ethyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]urea |
| SMILES | CCNC(=O)NCCc1ncno1 |
| InChI | InChI=1S/C7H12N4O2/c1-2-8-7(12)9-4-3-6-10-5-11-13-6/h5H,2-4H2,1H3,(H2,8,9,12) |
| InChIKey | IMVJFCZQYFOXGX-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |