C6H9N3O2 — CID 103743987
N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide (PubChem CID 103743987) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide.
| Compound Name | N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 103743987 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCc1ncno1 |
| InChI | InChI=1S/C6H9N3O2/c1-5(10)7-3-2-6-8-4-9-11-6/h4H,2-3H2,1H3,(H,7,10) |
| InChIKey | LYMZMLXHERAZMB-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |