About 2-ethoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide
2-ethoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide (PubChem CID 103744017) has the molecular formula C8H13N3O3
and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-ethoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-ethoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide |
| PubChem CID | 103744017 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-ethoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide |
| SMILES | CCOCC(=O)NCCc1ncno1 |
| InChI | InChI=1S/C8H13N3O3/c1-2-13-5-7(12)9-4-3-8-10-6-11-14-8/h6H,2-5H2,1H3,(H,9,12) |
| InChIKey | VRPFOLJCRQWKSM-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide?
The IUPAC name of 2-ethoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide (CID 103744017) is 2-ethoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide.
What is the SMILES notation for 2-ethoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide?
The canonical SMILES for 2-ethoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide is CCOCC(=O)NCCc1ncno1.
What is the InChIKey of 2-ethoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide?
The InChIKey is VRPFOLJCRQWKSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3/c1-2-13-5-7(12)9-4-3-8-10-6-11-14-8/h6H,2-5H2,1H3,(H,9,12).
What are the key properties of 2-ethoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide?
2-ethoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide has a molecular weight of 199.21 g/mol, XLogP of -0.24, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide is sourced from PubChem (CID 103744017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).