C8H13N3O2 — CID 103744048
N-[2-(1,2,4-oxadiazol-5-yl)ethyl]butanamide (PubChem CID 103744048) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is N-[2-(1,2,4-oxadiazol-5-yl)ethyl]butanamide.
| Compound Name | N-[2-(1,2,4-oxadiazol-5-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 103744048 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | N-[2-(1,2,4-oxadiazol-5-yl)ethyl]butanamide |
| SMILES | CCCC(=O)NCCc1ncno1 |
| InChI | InChI=1S/C8H13N3O2/c1-2-3-7(12)9-5-4-8-10-6-11-13-8/h6H,2-5H2,1H3,(H,9,12) |
| InChIKey | FBNKYLIDQHAYRB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |