About 2-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide
2-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide (PubChem CID 103744052) has the molecular formula C7H11N3O3
and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide |
| PubChem CID | 103744052 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 2-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide |
| SMILES | COCC(=O)NCCc1ncno1 |
| InChI | InChI=1S/C7H11N3O3/c1-12-4-6(11)8-3-2-7-9-5-10-13-7/h5H,2-4H2,1H3,(H,8,11) |
| InChIKey | SQLFDAORNMJCKL-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide?
The IUPAC name of 2-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide (CID 103744052) is 2-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide.
What is the SMILES notation for 2-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide?
The canonical SMILES for 2-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide is COCC(=O)NCCc1ncno1.
What is the InChIKey of 2-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide?
The InChIKey is SQLFDAORNMJCKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O3/c1-12-4-6(11)8-3-2-7-9-5-10-13-7/h5H,2-4H2,1H3,(H,8,11).
What are the key properties of 2-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide?
2-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide has a molecular weight of 185.18 g/mol, XLogP of -0.63, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]acetamide is sourced from PubChem (CID 103744052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).